C21H17N7O3S2 — CID 59443727
1-[2-[[5-pyridin-2-ylsulfanyl-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443727) has the molecular formula C21H17N7O3S2 and a molecular weight of 479.55 g/mol. Its IUPAC name is 1-[2-[[5-pyridin-2-ylsulfanyl-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-pyridin-2-ylsulfanyl-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443727 |
| Molecular Formula | C21H17N7O3S2 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-[2-[[5-pyridin-2-ylsulfanyl-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1csc(Nc2ncc(Sc3ccccn3)cc2Oc2ccn3cnnc3c2)n1 |
| InChI | InChI=1S/C21H17N7O3S2/c29-10-16(30)15-11-32-21(25-15)26-20-17(31-13-4-6-28-12-24-27-18(28)7-13)8-14(9-23-20)33-19-3-1-2-5-22-19/h1-9,11-12,16,29-30H,10H2,(H,23,25,26) |
| InChIKey | CJPQGYHZWUCGFO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |