C23H22N6O3S2 — CID 59443733
1-[2-[[5-pyridin-2-ylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443733) has the molecular formula C23H22N6O3S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 1-[2-[[5-pyridin-2-ylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-pyridin-2-ylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443733 |
| Molecular Formula | C23H22N6O3S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1-[2-[[5-pyridin-2-ylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1csc(Nc2ncc(Sc3ccccn3)cc2OC2CCCc3ncncc32)n1 |
| InChI | InChI=1S/C23H22N6O3S2/c30-11-18(31)17-12-33-23(28-17)29-22-20(8-14(9-26-22)34-21-6-1-2-7-25-21)32-19-5-3-4-16-15(19)10-24-13-27-16/h1-2,6-10,12-13,18-19,30-31H,3-5,11H2,(H,26,28,29) |
| InChIKey | FMYGKVHSSALUOY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |