C16H17BClF3N2O4 — CID 59443895
methyl 3-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 59443895) has the molecular formula C16H17BClF3N2O4 and a molecular weight of 404.58 g/mol. Its IUPAC name is methyl 3-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | methyl 3-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59443895 |
| Molecular Formula | C16H17BClF3N2O4 |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | methyl 3-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc2c(C(F)(F)F)cc(B3OC(C)(C)C(C)(C)O3)cn2c1Cl |
| InChI | InChI=1S/C16H17BClF3N2O4/c1-14(2)15(3,4)27-17(26-14)8-6-9(16(19,20)21)12-22-10(13(24)25-5)11(18)23(12)7-8/h6-7H,1-5H3 |
| InChIKey | MBCCXHDZTKCDRV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|