About CID 59444659
CID 59444659 (PubChem CID 59444659) has the molecular formula C24H20CrN6
and a molecular weight of 444.46 g/mol.
Molecular Properties
| Compound Name | CID 59444659 |
| PubChem CID | 59444659 |
| Molecular Formula | C24H20CrN6 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | — |
| SMILES | [CH]([N-][CH]c1ccccn1)c1ccccn1.[CH]([N-][CH]c1ccccn1)c1ccccn1.[Cr+2] |
| InChI | InChI=1S/2C12H10N3.Cr/c2*1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12;/h2*1-10H;/q2*-1;+2 |
| InChIKey | BTKPFQQCLFYGMB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 59444659 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59444659?
The IUPAC name of CID 59444659 (CID 59444659) is not available.
What is the SMILES notation for CID 59444659?
The canonical SMILES for CID 59444659 is [CH]([N-][CH]c1ccccn1)c1ccccn1.[CH]([N-][CH]c1ccccn1)c1ccccn1.[Cr+2].
What is the InChIKey of CID 59444659?
The InChIKey is BTKPFQQCLFYGMB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10N3.Cr/c2*1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12;/h2*1-10H;/q2*-1;+2.
What are the key properties of CID 59444659?
CID 59444659 has a molecular weight of 444.46 g/mol, XLogP of 5.14, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59444659 is sourced from PubChem (CID 59444659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).