About N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine
N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine (PubChem CID 59444700) has the molecular formula C5H8F3N3
and a molecular weight of 167.13 g/mol. Its IUPAC name is N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine.
Molecular Properties
| Compound Name | N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine |
| PubChem CID | 59444700 |
| Molecular Formula | C5H8F3N3 |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine |
| SMILES | [H]/N=C(C(\C)=N/NC)/C(F)(F)F |
| InChI | InChI=1S/C5H8F3N3/c1-3(11-10-2)4(9)5(6,7)8/h9-10H,1-2H3/b9-4+,11-3- |
| InChIKey | YKQYMKBYSDRFBB-JSRZTGKBSA-N |
| XLogP | 1.16 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine?
The IUPAC name of N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine (CID 59444700) is N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine.
What is the SMILES notation for N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine?
The canonical SMILES for N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine is [H]/N=C(C(\C)=N/NC)/C(F)(F)F.
What is the InChIKey of N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine?
The InChIKey is YKQYMKBYSDRFBB-JSRZTGKBSA-N. The full InChI is InChI=1S/C5H8F3N3/c1-3(11-10-2)4(9)5(6,7)8/h9-10H,1-2H3/b9-4+,11-3-.
What are the key properties of N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine?
N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine has a molecular weight of 167.13 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(4,4,4-trifluoro-3-iminobutan-2-ylidene)amino]methanamine is sourced from PubChem (CID 59444700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).