C18H28O5 — CID 59444764
(4R,7R,8S,9E,11S,12S)-4,7,8-trihydroxy-7,11-dimethyl-12-[(2E)-penta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 59444764) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4R,7R,8S,9E,11S,12S)-4,7,8-trihydroxy-7,11-dimethyl-12-[(2E)-penta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7R,8S,9E,11S,12S)-4,7,8-trihydroxy-7,11-dimethyl-12-[(2E)-penta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 59444764 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (4R,7R,8S,9E,11S,12S)-4,7,8-trihydroxy-7,11-dimethyl-12-[(2E)-penta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | C=C/C=C(\C)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](O)/C=C/[C@@H]1C |
| InChI | InChI=1S/C18H28O5/c1-5-6-12(2)17-13(3)7-8-15(20)18(4,22)10-9-14(19)11-16(21)23-17/h5-8,13-15,17,19-20,22H,1,9-11H2,2-4H3/b8-7+,12-6+/t13-,14+,15-,17+,18+/m0/s1 |
| InChIKey | FYSVZBZYGYUODV-LDUAGKCGSA-N |
| XLogP | 1.88 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|