C9H10O5 — CID 59444807
[(3aR,5R)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] formate (PubChem CID 59444807) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is [(3aR,5R)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] formate.
| Compound Name | [(3aR,5R)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] formate |
|---|---|
| PubChem CID | 59444807 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | [(3aR,5R)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] formate |
| SMILES | O=CO[C@@H]1CC2OC(=O)C[C@@H]2C1C=O |
| InChI | InChI=1S/C9H10O5/c10-3-6-5-1-9(12)14-8(5)2-7(6)13-4-11/h3-8H,1-2H2/t5-,6?,7-,8?/m1/s1 |
| InChIKey | MKNNVRQIYJHHSS-RYVOCIFZSA-N |
| XLogP | -0.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|