C36H22F16O4 — CID 59445267
[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-(4-phenylbenzoyl)oxydecyl] 4-phenylbenzoate (PubChem CID 59445267) has the molecular formula C36H22F16O4 and a molecular weight of 822.54 g/mol. Its IUPAC name is [2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-(4-phenylbenzoyl)oxydecyl] 4-phenylbenzoate.
| Compound Name | [2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-(4-phenylbenzoyl)oxydecyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 59445267 |
| Molecular Formula | C36H22F16O4 |
| Molecular Weight | 822.54 g/mol |
| Exact Mass | 822.13 |
| IUPAC Name | [2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-(4-phenylbenzoyl)oxydecyl] 4-phenylbenzoate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H22F16O4/c37-29(38,19-55-27(53)25-15-11-23(12-16-25)21-7-3-1-4-8-21)31(41,42)33(45,46)35(49,50)36(51,52)34(47,48)32(43,44)30(39,40)20-56-28(54)26-17-13-24(14-18-26)22-9-5-2-6-10-22/h1-18H,19-20H2 |
| InChIKey | CKSCMKPMFXWCKV-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.54 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|