C18H14N4O4S3 — CID 59445275
4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,1,3-benzothiadiazole-5,6-diamine (PubChem CID 59445275) has the molecular formula C18H14N4O4S3 and a molecular weight of 446.54 g/mol. Its IUPAC name is 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,1,3-benzothiadiazole-5,6-diamine.
| Compound Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,1,3-benzothiadiazole-5,6-diamine |
|---|---|
| PubChem CID | 59445275 |
| Molecular Formula | C18H14N4O4S3 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,1,3-benzothiadiazole-5,6-diamine |
| SMILES | Nc1c(N)c(-c2scc3c2OCCO3)c2nsnc2c1-c1scc2c1OCCO2 |
| InChI | InChI=1S/C18H14N4O4S3/c19-11-9(17-15-7(5-27-17)23-1-3-25-15)13-14(22-29-21-13)10(12(11)20)18-16-8(6-28-18)24-2-4-26-16/h5-6H,1-4,19-20H2 |
| InChIKey | YDRDENIHGXMANI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|