C19H12F6O5S — CID 59445726
2-(anthracene-9-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 59445726) has the molecular formula C19H12F6O5S and a molecular weight of 466.36 g/mol. Its IUPAC name is 2-(anthracene-9-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 2-(anthracene-9-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59445726 |
| Molecular Formula | C19H12F6O5S |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 2-(anthracene-9-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H12F6O5S/c20-18(21,22)17(19(23,24)25,10-31(27,28)29)30-16(26)15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9H,10H2,(H,27,28,29) |
| InChIKey | ILYCOKOJDRHNDM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|