C17H19F6O5S- — CID 59445727
3,3,3-trifluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 59445727) has the molecular formula C17H19F6O5S- and a molecular weight of 449.39 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 59445727 |
| Molecular Formula | C17H19F6O5S- |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 3,3,3-trifluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | O=C(OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C17H20F6O5S/c18-16(19,20)15(17(21,22)23,6-29(25,26)27)28-14(24)11-5-9-4-10(11)13-8-2-1-7(3-8)12(9)13/h7-13H,1-6H2,(H,25,26,27)/p-1 |
| InChIKey | RAVIKUGMYOFSHL-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|