C20H20N3O+ — CID 59445850
4-(2,4-dimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene (PubChem CID 59445850) has the molecular formula C20H20N3O+ and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene.
| Compound Name | 4-(2,4-dimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
|---|---|
| PubChem CID | 59445850 |
| Molecular Formula | C20H20N3O+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
| SMILES | Cc1ccc(-n2c[n+]3c(n2)COC2Cc4ccccc4C23)c(C)c1 |
| InChI | InChI=1S/C20H20N3O/c1-13-7-8-17(14(2)9-13)23-12-22-19(21-23)11-24-18-10-15-5-3-4-6-16(15)20(18)22/h3-9,12,18,20H,10-11H2,1-2H3/q+1 |
| InChIKey | JVBBJPPELQPMQC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|