C10H12O4 — CID 59445925
(1'R,5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one (PubChem CID 59445925) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (1'R,5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one.
| Compound Name | (1'R,5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one |
|---|---|
| PubChem CID | 59445925 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1'R,5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one |
| SMILES | C[C@]12C=C[C@@H](O1)C(=O)CC21OCCO1 |
| InChI | InChI=1S/C10H12O4/c1-9-3-2-8(14-9)7(11)6-10(9)12-4-5-13-10/h2-3,8H,4-6H2,1H3/t8-,9-/m1/s1 |
| InChIKey | OFUMMRJQWXHQTC-RKDXNWHRSA-N |
| XLogP | 0.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|