C15H26O6 — CID 59445977
[(2R)-2-[(2R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-non-5-enoate (PubChem CID 59445977) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(2R)-2-[(2R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-non-5-enoate.
| Compound Name | [(2R)-2-[(2R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-non-5-enoate |
|---|---|
| PubChem CID | 59445977 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [(2R)-2-[(2R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-non-5-enoate |
| SMILES | CCC/C=C\CCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)C1O |
| InChI | InChI=1S/C15H26O6/c1-2-3-4-5-6-7-8-13(18)20-10-12(17)15-14(19)11(16)9-21-15/h4-5,11-12,14-17,19H,2-3,6-10H2,1H3/b5-4-/t11-,12+,14?,15+/m0/s1 |
| InChIKey | INMDAVZQTVAYRF-NQHZDWNTSA-N |
| XLogP | 0.54 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|