C16H34NO+ — CID 59446157
[(2R)-2-hydroxy-3,3,4,5,6,7-hexamethylcycloheptyl]-trimethylazanium (PubChem CID 59446157) has the molecular formula C16H34NO+ and a molecular weight of 256.45 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3,3,4,5,6,7-hexamethylcycloheptyl]-trimethylazanium.
| Compound Name | [(2R)-2-hydroxy-3,3,4,5,6,7-hexamethylcycloheptyl]-trimethylazanium |
|---|---|
| PubChem CID | 59446157 |
| Molecular Formula | C16H34NO+ |
| Molecular Weight | 256.45 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | [(2R)-2-hydroxy-3,3,4,5,6,7-hexamethylcycloheptyl]-trimethylazanium |
| SMILES | CC1C(C)C(C)C(C)(C)[C@@H](O)C([N+](C)(C)C)C1C |
| InChI | InChI=1S/C16H34NO/c1-10-11(2)13(4)16(5,6)15(18)14(12(10)3)17(7,8)9/h10-15,18H,1-9H3/q+1/t10?,11?,12?,13?,14?,15-/m0/s1 |
| InChIKey | YHVPWQHDBVAHHH-FFSGTFEZSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|