About [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium
[(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium (PubChem CID 59446164) has the molecular formula C10H22NO2+
and a molecular weight of 188.29 g/mol. Its IUPAC name is [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium.
Molecular Properties
| Compound Name | [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium |
| PubChem CID | 59446164 |
| Molecular Formula | C10H22NO2+ |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium |
| SMILES | CC1OC(C)(C)C([N+](C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C10H22NO2/c1-7-8(12)9(11(4,5)6)10(2,3)13-7/h7-9,12H,1-6H3/q+1/t7?,8-,9?/m1/s1 |
| InChIKey | IYAOSTBUDKYNRZ-QJAFJHJLSA-N |
| XLogP | 0.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium?
The IUPAC name of [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium (CID 59446164) is [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium.
What is the SMILES notation for [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium?
The canonical SMILES for [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium is CC1OC(C)(C)C([N+](C)(C)C)[C@@H]1O.
What is the InChIKey of [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium?
The InChIKey is IYAOSTBUDKYNRZ-QJAFJHJLSA-N. The full InChI is InChI=1S/C10H22NO2/c1-7-8(12)9(11(4,5)6)10(2,3)13-7/h7-9,12H,1-6H3/q+1/t7?,8-,9?/m1/s1.
What are the key properties of [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium?
[(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium has a molecular weight of 188.29 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-hydroxy-2,2,5-trimethyloxolan-3-yl]-trimethylazanium is sourced from PubChem (CID 59446164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).