About pentan-3-ol
pentan-3-ol (PubChem CID 59446175) has the molecular formula C5H11O+
and a molecular weight of 87.14 g/mol. Its IUPAC name is pentan-3-ol.
Molecular Properties
| Compound Name | pentan-3-ol |
| PubChem CID | 59446175 |
| Molecular Formula | C5H11O+ |
| Molecular Weight | 87.14 g/mol |
| Exact Mass | 87.08 |
| IUPAC Name | pentan-3-ol |
| SMILES | C[CH+]C(O)CC |
| InChI | InChI=1S/C5H11O/c1-3-5(6)4-2/h3,5-6H,4H2,1-2H3/q+1 |
| InChIKey | QWLAUNNKHVOWQZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-ol?
The IUPAC name of pentan-3-ol (CID 59446175) is pentan-3-ol.
What is the SMILES notation for pentan-3-ol?
The canonical SMILES for pentan-3-ol is C[CH+]C(O)CC.
What is the InChIKey of pentan-3-ol?
The InChIKey is QWLAUNNKHVOWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O/c1-3-5(6)4-2/h3,5-6H,4H2,1-2H3/q+1.
What are the key properties of pentan-3-ol?
pentan-3-ol has a molecular weight of 87.14 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-ol is sourced from PubChem (CID 59446175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).