C23H22Cl2N5O7PS2 — CID 59446491
[(3,5-dichlorophenyl)sulfonyl-[1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridazin-3-yl]indol-5-yl]amino]methylphosphonic acid (PubChem CID 59446491) has the molecular formula C23H22Cl2N5O7PS2 and a molecular weight of 646.47 g/mol. Its IUPAC name is [(3,5-dichlorophenyl)sulfonyl-[1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridazin-3-yl]indol-5-yl]amino]methylphosphonic acid.
| Compound Name | [(3,5-dichlorophenyl)sulfonyl-[1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridazin-3-yl]indol-5-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 59446491 |
| Molecular Formula | C23H22Cl2N5O7PS2 |
| Molecular Weight | 646.47 g/mol |
| Exact Mass | 645.01 |
| IUPAC Name | [(3,5-dichlorophenyl)sulfonyl-[1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridazin-3-yl]indol-5-yl]amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCS(=O)(=O)CC3)nn2)c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2N5O7PS2/c24-17-12-18(25)14-20(13-17)40(36,37)30(15-38(31,32)33)19-1-2-21-16(11-19)5-6-29(21)23-4-3-22(26-27-23)28-7-9-39(34,35)10-8-28/h1-6,11-14H,7-10,15H2,(H2,31,32,33) |
| InChIKey | NGRPVTBOXGREJL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 163.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|