C31H37IN4O4S2Si — CID 59447574
tert-butyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-iodo-1,3-thiazole-4-carboxylate (PubChem CID 59447574) has the molecular formula C31H37IN4O4S2Si and a molecular weight of 748.79 g/mol. Its IUPAC name is tert-butyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-iodo-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-iodo-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59447574 |
| Molecular Formula | C31H37IN4O4S2Si |
| Molecular Weight | 748.79 g/mol |
| Exact Mass | 748.11 |
| IUPAC Name | tert-butyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-iodo-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc(N2CCc3cccc(C(=O)N(COCC[Si](C)(C)C)c4nc5ccccc5s4)c3C2)sc1I |
| InChI | InChI=1S/C31H37IN4O4S2Si/c1-31(2,3)40-28(38)25-26(32)42-29(34-25)35-15-14-20-10-9-11-21(22(20)18-35)27(37)36(19-39-16-17-43(4,5)6)30-33-23-12-7-8-13-24(23)41-30/h7-13H,14-19H2,1-6H3 |
| InChIKey | XCXWVPXEOOCCMG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.79 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|