C27H27IN4O3S2 — CID 59447633
ethyl 2-[8-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-(4-iodobutyl)-1,3-thiazole-4-carboxylate (PubChem CID 59447633) has the molecular formula C27H27IN4O3S2 and a molecular weight of 646.58 g/mol. Its IUPAC name is ethyl 2-[8-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-(4-iodobutyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[8-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-(4-iodobutyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59447633 |
| Molecular Formula | C27H27IN4O3S2 |
| Molecular Weight | 646.58 g/mol |
| Exact Mass | 646.06 |
| IUPAC Name | ethyl 2-[8-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-(4-iodobutyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N2CCc3cccc(C(=O)Nc4nc5ccccc5s4)c3C2)sc1CCCCI |
| InChI | InChI=1S/C27H27IN4O3S2/c1-2-35-25(34)23-22(12-5-6-14-28)37-27(30-23)32-15-13-17-8-7-9-18(19(17)16-32)24(33)31-26-29-20-10-3-4-11-21(20)36-26/h3-4,7-11H,2,5-6,12-16H2,1H3,(H,29,31,33) |
| InChIKey | HAYRMDFLADVUGU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|