C39H46N6O4S2Si — CID 59447670
methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-[(4-phenylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 59447670) has the molecular formula C39H46N6O4S2Si and a molecular weight of 755.06 g/mol. Its IUPAC name is methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-[(4-phenylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-[(4-phenylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59447670 |
| Molecular Formula | C39H46N6O4S2Si |
| Molecular Weight | 755.06 g/mol |
| Exact Mass | 754.28 |
| IUPAC Name | methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-[(4-phenylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(N2CCc3cccc(C(=O)N(COCC[Si](C)(C)C)c4nc5ccccc5s4)c3C2)sc1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C39H46N6O4S2Si/c1-48-37(47)35-34(26-42-19-21-43(22-20-42)29-12-6-5-7-13-29)51-38(41-35)44-18-17-28-11-10-14-30(31(28)25-44)36(46)45(27-49-23-24-52(2,3)4)39-40-32-15-8-9-16-33(32)50-39/h5-16H,17-27H2,1-4H3 |
| InChIKey | BEQGMABBXQWZHZ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.06 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|