C12H12N2O2 — CID 59448125
4,5-dimethyl-2-phenyl-1H-pyridazine-3,6-dione (PubChem CID 59448125) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4,5-dimethyl-2-phenyl-1H-pyridazine-3,6-dione.
| Compound Name | 4,5-dimethyl-2-phenyl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 59448125 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4,5-dimethyl-2-phenyl-1H-pyridazine-3,6-dione |
| SMILES | Cc1c(C)c(=O)n(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C12H12N2O2/c1-8-9(2)12(16)14(13-11(8)15)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,13,15) |
| InChIKey | FETYWPKZEKGQFG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |