C23H16N6O10S2 — CID 59448154
1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 59448154) has the molecular formula C23H16N6O10S2 and a molecular weight of 600.55 g/mol. Its IUPAC name is 1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 59448154 |
| Molecular Formula | C23H16N6O10S2 |
| Molecular Weight | 600.55 g/mol |
| Exact Mass | 600.04 |
| IUPAC Name | 1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(Nc3nc(=O)[nH]c(=O)[nH]3)cc2S(=O)(=O)O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H16N6O10S2/c24-18-15(41(37,38)39)8-13(16-17(18)20(31)11-4-2-1-3-10(11)19(16)30)26-12-6-5-9(7-14(12)40(34,35)36)25-21-27-22(32)29-23(33)28-21/h1-8,26H,24H2,(H,34,35,36)(H,37,38,39)(H3,25,27,28,29,32,33) |
| InChIKey | AKNKUZGNFDPJFT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 271.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.55 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|