C26H26ClN7O3 — CID 59448245
3-[4-[[4-[(2-chloro-4-isocyanophenyl)methylcarbamoyl]cyclohexyl]amino]-6-(methylamino)-1,3,5-triazin-2-yl]benzoic acid (PubChem CID 59448245) has the molecular formula C26H26ClN7O3 and a molecular weight of 519.99 g/mol. Its IUPAC name is 3-[4-[[4-[(2-chloro-4-isocyanophenyl)methylcarbamoyl]cyclohexyl]amino]-6-(methylamino)-1,3,5-triazin-2-yl]benzoic acid.
| Compound Name | 3-[4-[[4-[(2-chloro-4-isocyanophenyl)methylcarbamoyl]cyclohexyl]amino]-6-(methylamino)-1,3,5-triazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 59448245 |
| Molecular Formula | C26H26ClN7O3 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 3-[4-[[4-[(2-chloro-4-isocyanophenyl)methylcarbamoyl]cyclohexyl]amino]-6-(methylamino)-1,3,5-triazin-2-yl]benzoic acid |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)C2CCC(Nc3nc(NC)nc(-c4cccc(C(=O)O)c4)n3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C26H26ClN7O3/c1-28-20-11-8-18(21(27)13-20)14-30-23(35)15-6-9-19(10-7-15)31-26-33-22(32-25(29-2)34-26)16-4-3-5-17(12-16)24(36)37/h3-5,8,11-13,15,19H,6-7,9-10,14H2,2H3,(H,30,35)(H,36,37)(H2,29,31,32,33,34) |
| InChIKey | YVHONHFIWLDAQD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|