About 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione
1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione (PubChem CID 59448368) has the molecular formula C13H18N4O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione |
| PubChem CID | 59448368 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione |
| SMILES | COC(CCn1cc(-c2cnn(C)c2)c(=O)[nH]c1=O)OC |
| InChI | InChI=1S/C13H18N4O4/c1-16-7-9(6-14-16)10-8-17(13(19)15-12(10)18)5-4-11(20-2)21-3/h6-8,11H,4-5H2,1-3H3,(H,15,18,19) |
| InChIKey | JIKYVQJDCHFXEV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione?
The IUPAC name of 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione (CID 59448368) is 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione?
The canonical SMILES for 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione is COC(CCn1cc(-c2cnn(C)c2)c(=O)[nH]c1=O)OC.
What is the InChIKey of 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione?
The InChIKey is JIKYVQJDCHFXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O4/c1-16-7-9(6-14-16)10-8-17(13(19)15-12(10)18)5-4-11(20-2)21-3/h6-8,11H,4-5H2,1-3H3,(H,15,18,19).
What are the key properties of 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione?
1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione has a molecular weight of 294.31 g/mol, XLogP of -0.05, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethoxypropyl)-5-(1-methylpyrazol-4-yl)pyrimidine-2,4-dione is sourced from PubChem (CID 59448368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).