C12H13Cl2NO — CID 59448531
(3aR,9bR)-6,9-dichloro-3a-methyl-2,3,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole (PubChem CID 59448531) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is (3aR,9bR)-6,9-dichloro-3a-methyl-2,3,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole.
| Compound Name | (3aR,9bR)-6,9-dichloro-3a-methyl-2,3,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 59448531 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (3aR,9bR)-6,9-dichloro-3a-methyl-2,3,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole |
| SMILES | C[C@]12CNC[C@H]1c1c(Cl)ccc(Cl)c1CO2 |
| InChI | InChI=1S/C12H13Cl2NO/c1-12-6-15-4-8(12)11-7(5-16-12)9(13)2-3-10(11)14/h2-3,8,15H,4-6H2,1H3/t8-,12-/m0/s1 |
| InChIKey | JWYJDWLEYSSVRU-UFBFGSQYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |