C24H14N4O6S4 — CID 59449067
5-[2-(5-isocyano-4-methyl-2,6-dioxo-3-pyridinylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 59449067) has the molecular formula C24H14N4O6S4 and a molecular weight of 582.67 g/mol. Its IUPAC name is 5-[2-(5-isocyano-4-methyl-2,6-dioxo-3-pyridinylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 5-[2-(5-isocyano-4-methyl-2,6-dioxo-3-pyridinylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59449067 |
| Molecular Formula | C24H14N4O6S4 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 581.98 |
| IUPAC Name | 5-[2-(5-isocyano-4-methyl-2,6-dioxo-3-pyridinylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]C1=C(C)C(=C2Sc3c(OC)c4c(c(OC)c3S2)SC(=C2C(=O)NC(=O)C(C#N)=C2C)S4)C(=O)NC1=O |
| InChI | InChI=1S/C24H14N4O6S4/c1-7-9(6-25)19(29)27-20(30)10(7)23-35-15-13(33-4)17-18(14(34-5)16(15)36-23)38-24(37-17)11-8(2)12(26-3)22(32)28-21(11)31/h1-2,4-5H3,(H,27,29,30)(H,28,31,32)/b23-10-,24-11- |
| InChIKey | WKTQHJFSKSFNNX-LXBWIMAGSA-N |
| XLogP | 3.87 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|