C16H18O4 — CID 59449156
dimethyl tetracyclo[5.4.1.02,6.08,11]dodeca-3,9-diene-9,10-dicarboxylate (PubChem CID 59449156) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is dimethyl tetracyclo[5.4.1.02,6.08,11]dodeca-3,9-diene-9,10-dicarboxylate.
| Compound Name | dimethyl tetracyclo[5.4.1.02,6.08,11]dodeca-3,9-diene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59449156 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | dimethyl tetracyclo[5.4.1.02,6.08,11]dodeca-3,9-diene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C3CC(C4C=CCC43)C12 |
| InChI | InChI=1S/C16H18O4/c1-19-15(17)13-11-9-6-10(8-5-3-4-7(8)9)12(11)14(13)16(18)20-2/h3-4,7-12H,5-6H2,1-2H3 |
| InChIKey | JDARFCUNMCFVAR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|