About [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate
[4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate (PubChem CID 59449334) has the molecular formula C46H34N4O4
and a molecular weight of 706.80 g/mol. Its IUPAC name is [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate.
Molecular Properties
| Compound Name | [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate |
| PubChem CID | 59449334 |
| Molecular Formula | C46H34N4O4 |
| Molecular Weight | 706.80 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate |
| SMILES | CCn1c(-c2cc(OC(=O)c3ccccc3)c(-c3nc4ccc5ccccc5c4n3CC)cc2OC(=O)c2ccccc2)nc2ccc3ccccc3c21 |
| InChI | InChI=1S/C46H34N4O4/c1-3-49-41-33-21-13-11-15-29(33)23-25-37(41)47-43(49)35-27-40(54-46(52)32-19-9-6-10-20-32)36(28-39(35)53-45(51)31-17-7-5-8-18-31)44-48-38-26-24-30-16-12-14-22-34(30)42(38)50(44)4-2/h5-28H,3-4H2,1-2H3 |
| InChIKey | SMARELMJLZUYCT-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 706.80 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate?
The IUPAC name of [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate (CID 59449334) is [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate.
What is the SMILES notation for [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate?
The canonical SMILES for [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate is CCn1c(-c2cc(OC(=O)c3ccccc3)c(-c3nc4ccc5ccccc5c4n3CC)cc2OC(=O)c2ccccc2)nc2ccc3ccccc3c21.
What is the InChIKey of [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate?
The InChIKey is SMARELMJLZUYCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H34N4O4/c1-3-49-41-33-21-13-11-15-29(33)23-25-37(41)47-43(49)35-27-40(54-46(52)32-19-9-6-10-20-32)36(28-39(35)53-45(51)31-17-7-5-8-18-31)44-48-38-26-24-30-16-12-14-22-34(30)42(38)50(44)4-2/h5-28H,3-4H2,1-2H3.
What are the key properties of [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate?
[4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate has a molecular weight of 706.80 g/mol, XLogP of 10.50, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-benzoyloxy-2,5-bis(1-ethylbenzo[e]benzimidazol-2-yl)phenyl] benzoate is sourced from PubChem (CID 59449334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).