C14H12Cl2N4O3 — CID 594494
7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione (PubChem CID 594494) has the molecular formula C14H12Cl2N4O3 and a molecular weight of 355.18 g/mol. Its IUPAC name is 7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione.
| Compound Name | 7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 594494 |
| Molecular Formula | C14H12Cl2N4O3 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione |
| SMILES | Cn1c(=O)c2c([nH]c(=O)n2Cc2ccc(Cl)cc2Cl)n(C)c1=O |
| InChI | InChI=1S/C14H12Cl2N4O3/c1-18-11-10(12(21)19(2)14(18)23)20(13(22)17-11)6-7-3-4-8(15)5-9(7)16/h3-5H,6H2,1-2H3,(H,17,22) |
| InChIKey | SJBMGAWFKNPLNJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |