About O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate
O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate (PubChem CID 59449523) has the molecular formula C14H24O2S2
and a molecular weight of 288.48 g/mol. Its IUPAC name is O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate |
| PubChem CID | 59449523 |
| Molecular Formula | C14H24O2S2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate |
| SMILES | CCC(C)(C)C1CCC(=O)C1SC(=S)OC(C)C |
| InChI | InChI=1S/C14H24O2S2/c1-6-14(4,5)10-7-8-11(15)12(10)18-13(17)16-9(2)3/h9-10,12H,6-8H2,1-5H3 |
| InChIKey | ZUMXEJQGWGVYFA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate?
The IUPAC name of O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate (CID 59449523) is O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate.
What is the SMILES notation for O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate?
The canonical SMILES for O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate is CCC(C)(C)C1CCC(=O)C1SC(=S)OC(C)C.
What is the InChIKey of O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate?
The InChIKey is ZUMXEJQGWGVYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2S2/c1-6-14(4,5)10-7-8-11(15)12(10)18-13(17)16-9(2)3/h9-10,12H,6-8H2,1-5H3.
What are the key properties of O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate?
O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate has a molecular weight of 288.48 g/mol, XLogP of 4.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-propan-2-yl [2-(2-methylbutan-2-yl)-5-oxocyclopentyl]sulfanylmethanethioate is sourced from PubChem (CID 59449523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).