C27H16F26O7S — CID 59449618
bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) (E)-2-(4-methylphenyl)sulfonyloxybut-2-enedioate (PubChem CID 59449618) has the molecular formula C27H16F26O7S and a molecular weight of 978.43 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) (E)-2-(4-methylphenyl)sulfonyloxybut-2-enedioate.
| Compound Name | bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) (E)-2-(4-methylphenyl)sulfonyloxybut-2-enedioate |
|---|---|
| PubChem CID | 59449618 |
| Molecular Formula | C27H16F26O7S |
| Molecular Weight | 978.43 g/mol |
| Exact Mass | 978.02 |
| IUPAC Name | bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) (E)-2-(4-methylphenyl)sulfonyloxybut-2-enedioate |
| SMILES | Cc1ccc(S(=O)(=O)O/C(=C/C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H16F26O7S/c1-11-2-4-12(5-3-11)61(56,57)60-13(15(55)59-9-7-17(30,31)19(34,35)21(38,39)23(42,43)25(46,47)27(51,52)53)10-14(54)58-8-6-16(28,29)18(32,33)20(36,37)22(40,41)24(44,45)26(48,49)50/h2-5,10H,6-9H2,1H3/b13-10+ |
| InChIKey | OIQMJKCWYKAANJ-JLHYYAGUSA-N |
| XLogP | 9.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.43 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|