About 3,4,5,6-tetramethyl-2H-pyran
3,4,5,6-tetramethyl-2H-pyran (PubChem CID 59449832) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 3,4,5,6-tetramethyl-2H-pyran.
Molecular Properties
| Compound Name | 3,4,5,6-tetramethyl-2H-pyran |
| PubChem CID | 59449832 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 3,4,5,6-tetramethyl-2H-pyran |
| SMILES | CC1=C(C)C(C)=C(C)OC1 |
| InChI | InChI=1S/C9H14O/c1-6-5-10-9(4)8(3)7(6)2/h5H2,1-4H3 |
| InChIKey | JISDFVKKJPOYDV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4,5,6-tetramethyl-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5,6-tetramethyl-2H-pyran?
The IUPAC name of 3,4,5,6-tetramethyl-2H-pyran (CID 59449832) is 3,4,5,6-tetramethyl-2H-pyran.
What is the SMILES notation for 3,4,5,6-tetramethyl-2H-pyran?
The canonical SMILES for 3,4,5,6-tetramethyl-2H-pyran is CC1=C(C)C(C)=C(C)OC1.
What is the InChIKey of 3,4,5,6-tetramethyl-2H-pyran?
The InChIKey is JISDFVKKJPOYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-6-5-10-9(4)8(3)7(6)2/h5H2,1-4H3.
What are the key properties of 3,4,5,6-tetramethyl-2H-pyran?
3,4,5,6-tetramethyl-2H-pyran has a molecular weight of 138.21 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,6-tetramethyl-2H-pyran is sourced from PubChem (CID 59449832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).