C16H18O3 — CID 59449834
2,4,8,8,8a-pentamethylcyclopenta[f][1]benzofuran-5,7-dione (PubChem CID 59449834) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,4,8,8,8a-pentamethylcyclopenta[f][1]benzofuran-5,7-dione.
| Compound Name | 2,4,8,8,8a-pentamethylcyclopenta[f][1]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 59449834 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2,4,8,8,8a-pentamethylcyclopenta[f][1]benzofuran-5,7-dione |
| SMILES | CC1=CC2=C(C)C3=C(C(=O)CC3=O)C(C)(C)C2(C)O1 |
| InChI | InChI=1S/C16H18O3/c1-8-6-10-9(2)13-11(17)7-12(18)14(13)15(3,4)16(10,5)19-8/h6H,7H2,1-5H3 |
| InChIKey | JNBYDRXSNHBFRI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|