C27H25NO4 — CID 59449840
1-(4-methoxyphenyl)-4,8,8,8a-tetramethyl-2-phenylfuro[3,4-f]indole-5,7-dione (PubChem CID 59449840) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4,8,8,8a-tetramethyl-2-phenylfuro[3,4-f]indole-5,7-dione.
| Compound Name | 1-(4-methoxyphenyl)-4,8,8,8a-tetramethyl-2-phenylfuro[3,4-f]indole-5,7-dione |
|---|---|
| PubChem CID | 59449840 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-4,8,8,8a-tetramethyl-2-phenylfuro[3,4-f]indole-5,7-dione |
| SMILES | COc1ccc(N2C(c3ccccc3)=CC3=C(C)C4=C(C(=O)OC4=O)C(C)(C)C32C)cc1 |
| InChI | InChI=1S/C27H25NO4/c1-16-20-15-21(17-9-7-6-8-10-17)28(18-11-13-19(31-5)14-12-18)27(20,4)26(2,3)23-22(16)24(29)32-25(23)30/h6-15H,1-5H3 |
| InChIKey | GDZCGIBPOICKLN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|