C20H5F15OSi — CID 59450332
methoxymethyl-tris(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 59450332) has the molecular formula C20H5F15OSi and a molecular weight of 574.32 g/mol. Its IUPAC name is methoxymethyl-tris(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | methoxymethyl-tris(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 59450332 |
| Molecular Formula | C20H5F15OSi |
| Molecular Weight | 574.32 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | methoxymethyl-tris(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | COC[Si](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H5F15OSi/c1-36-2-37(18-12(30)6(24)3(21)7(25)13(18)31,19-14(32)8(26)4(22)9(27)15(19)33)20-16(34)10(28)5(23)11(29)17(20)35/h2H2,1H3 |
| InChIKey | NSOLJOMLGFQHGR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|