(2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate

C13H22O4 — CID 59450428

IUPAC(2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate
SMILESCCC(C)C(=O)OC1CCCC(=O)OC1(C)C
InChIInChI=1S/C13H22O4/c1-5-9(2)12(15)16-10-7-6-8-11(14)17-13(10,3)4/h9-10H,5-8H2,1-4H3
InChIKeyWLLQEIONJDVTAG-UHFFFAOYSA-N
MW242.31 g/mol
LogP2.45
Rot. Bonds3

About (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate

(2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate (PubChem CID 59450428) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate.

Molecular Properties

Compound Name(2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate
PubChem CID59450428
Molecular FormulaC13H22O4
Molecular Weight242.31 g/mol
Exact Mass242.15
IUPAC Name(2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate
SMILESCCC(C)C(=O)OC1CCCC(=O)OC1(C)C
InChIInChI=1S/C13H22O4/c1-5-9(2)12(15)16-10-7-6-8-11(14)17-13(10,3)4/h9-10H,5-8H2,1-4H3
InChIKeyWLLQEIONJDVTAG-UHFFFAOYSA-N
XLogP2.45
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.31
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate?
The IUPAC name of (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate (CID 59450428) is (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate.
What is the SMILES notation for (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate?
The canonical SMILES for (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate is CCC(C)C(=O)OC1CCCC(=O)OC1(C)C.
What is the InChIKey of (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate?
The InChIKey is WLLQEIONJDVTAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-5-9(2)12(15)16-10-7-6-8-11(14)17-13(10,3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate?
(2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate has a molecular weight of 242.31 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-7-oxooxepan-3-yl) 2-methylbutanoate is sourced from PubChem (CID 59450428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).