C15H26O4 — CID 59450441
(5,7,7-trimethyl-2-oxooxepan-4-yl) 2,2-dimethylbutanoate (PubChem CID 59450441) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (5,7,7-trimethyl-2-oxooxepan-4-yl) 2,2-dimethylbutanoate.
| Compound Name | (5,7,7-trimethyl-2-oxooxepan-4-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59450441 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (5,7,7-trimethyl-2-oxooxepan-4-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(=O)OC(C)(C)CC1C |
| InChI | InChI=1S/C15H26O4/c1-7-14(3,4)13(17)18-11-8-12(16)19-15(5,6)9-10(11)2/h10-11H,7-9H2,1-6H3 |
| InChIKey | VUEVPBLYAOPLCG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |