About 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane
3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane (PubChem CID 59450550) has the molecular formula C23H30O2
and a molecular weight of 338.49 g/mol. Its IUPAC name is 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane.
Molecular Properties
| Compound Name | 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane |
| PubChem CID | 59450550 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane |
| SMILES | Cc1cc(OCC2(C)COC2)cc(C)c1-c1cccc(CC(C)C)c1 |
| InChI | InChI=1S/C23H30O2/c1-16(2)9-19-7-6-8-20(12-19)22-17(3)10-21(11-18(22)4)25-15-23(5)13-24-14-23/h6-8,10-12,16H,9,13-15H2,1-5H3 |
| InChIKey | ILUPMWQOSBJOTD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane?
The IUPAC name of 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane (CID 59450550) is 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane.
What is the SMILES notation for 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane?
The canonical SMILES for 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane is Cc1cc(OCC2(C)COC2)cc(C)c1-c1cccc(CC(C)C)c1.
What is the InChIKey of 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane?
The InChIKey is ILUPMWQOSBJOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O2/c1-16(2)9-19-7-6-8-20(12-19)22-17(3)10-21(11-18(22)4)25-15-23(5)13-24-14-23/h6-8,10-12,16H,9,13-15H2,1-5H3.
What are the key properties of 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane?
3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane has a molecular weight of 338.49 g/mol, XLogP of 5.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-dimethyl-4-[3-(2-methylpropyl)phenyl]phenoxy]methyl]-3-methyloxetane is sourced from PubChem (CID 59450550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).