About 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+)
2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) (PubChem CID 59450894) has the molecular formula C8H18NO2RbS
and a molecular weight of 277.77 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+).
Molecular Properties
| Compound Name | 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) |
| PubChem CID | 59450894 |
| Molecular Formula | C8H18NO2RbS |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) |
| SMILES | CC(C)CN(CC(C)C)[S-](=O)=O.[Rb+] |
| InChI | InChI=1S/C8H18NO2S.Rb/c1-7(2)5-9(12(10)11)6-8(3)4;/h7-8H,5-6H2,1-4H3;/q-1;+1 |
| InChIKey | YOVWUXRZJYUSKJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+)?
The IUPAC name of 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) (CID 59450894) is 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+).
What is the SMILES notation for 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+)?
The canonical SMILES for 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) is CC(C)CN(CC(C)C)[S-](=O)=O.[Rb+].
What is the InChIKey of 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+)?
The InChIKey is YOVWUXRZJYUSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18NO2S.Rb/c1-7(2)5-9(12(10)11)6-8(3)4;/h7-8H,5-6H2,1-4H3;/q-1;+1.
What are the key properties of 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+)?
2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) has a molecular weight of 277.77 g/mol, XLogP of -1.17, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(2-methylpropyl)-N-sulfinatopropan-1-amine;rubidium(1+) is sourced from PubChem (CID 59450894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).