About 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine
9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine (PubChem CID 594510) has the molecular formula C16H17Cl2N5
and a molecular weight of 350.25 g/mol. Its IUPAC name is 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine.
Molecular Properties
| Compound Name | 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine |
| PubChem CID | 594510 |
| Molecular Formula | C16H17Cl2N5 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine |
| SMILES | CCN(CC)c1ncnc2c1ncn2Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H17Cl2N5/c1-3-22(4-2)15-14-16(20-9-19-15)23(10-21-14)8-11-12(17)6-5-7-13(11)18/h5-7,9-10H,3-4,8H2,1-2H3 |
| InChIKey | ITJIOYIWZIUCSN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine?
The IUPAC name of 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine (CID 594510) is 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine.
What is the SMILES notation for 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine?
The canonical SMILES for 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine is CCN(CC)c1ncnc2c1ncn2Cc1c(Cl)cccc1Cl.
What is the InChIKey of 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine?
The InChIKey is ITJIOYIWZIUCSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N5/c1-3-22(4-2)15-14-16(20-9-19-15)23(10-21-14)8-11-12(17)6-5-7-13(11)18/h5-7,9-10H,3-4,8H2,1-2H3.
What are the key properties of 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine?
9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine has a molecular weight of 350.25 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,6-dichlorophenyl)methyl]-N,N-diethylpurin-6-amine is sourced from PubChem (CID 594510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).