C23H45N — CID 59451216
2,2,3,3,4,4,5,5-octamethyl-8,10-di(propan-2-yl)-10-azabicyclo[4.3.1]decane (PubChem CID 59451216) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octamethyl-8,10-di(propan-2-yl)-10-azabicyclo[4.3.1]decane.
| Compound Name | 2,2,3,3,4,4,5,5-octamethyl-8,10-di(propan-2-yl)-10-azabicyclo[4.3.1]decane |
|---|---|
| PubChem CID | 59451216 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octamethyl-8,10-di(propan-2-yl)-10-azabicyclo[4.3.1]decane |
| SMILES | CC(C)C1CC2N(C(C)C)C(C1)C(C)(C)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C23H45N/c1-15(2)17-13-18-20(5,6)22(9,10)23(11,12)21(7,8)19(14-17)24(18)16(3)4/h15-19H,13-14H2,1-12H3 |
| InChIKey | YWIXITCSXVYQJJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |