C23H13Cl2FN4O4 — CID 59451617
N-[[4-chloro-3-(3-chloro-5-cyanophenoxy)-2-fluorophenyl]methyl]-6-nitro-1H-indole-2-carboxamide (PubChem CID 59451617) has the molecular formula C23H13Cl2FN4O4 and a molecular weight of 499.29 g/mol. Its IUPAC name is N-[[4-chloro-3-(3-chloro-5-cyanophenoxy)-2-fluorophenyl]methyl]-6-nitro-1H-indole-2-carboxamide.
| Compound Name | N-[[4-chloro-3-(3-chloro-5-cyanophenoxy)-2-fluorophenyl]methyl]-6-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 59451617 |
| Molecular Formula | C23H13Cl2FN4O4 |
| Molecular Weight | 499.29 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | N-[[4-chloro-3-(3-chloro-5-cyanophenoxy)-2-fluorophenyl]methyl]-6-nitro-1H-indole-2-carboxamide |
| SMILES | N#Cc1cc(Cl)cc(Oc2c(Cl)ccc(CNC(=O)c3cc4ccc([N+](=O)[O-])cc4[nH]3)c2F)c1 |
| InChI | InChI=1S/C23H13Cl2FN4O4/c24-15-5-12(10-27)6-17(8-15)34-22-18(25)4-2-14(21(22)26)11-28-23(31)20-7-13-1-3-16(30(32)33)9-19(13)29-20/h1-9,29H,11H2,(H,28,31) |
| InChIKey | NHQSKVLYMHTZRC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.29 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|