C32H44N2O3 — CID 59451687
1-[(3E,13S,17S)-11-[4-(dimethylamino)phenyl]-3-methoxyimino-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-ethoxyethanone (PubChem CID 59451687) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is 1-[(3E,13S,17S)-11-[4-(dimethylamino)phenyl]-3-methoxyimino-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-ethoxyethanone.
| Compound Name | 1-[(3E,13S,17S)-11-[4-(dimethylamino)phenyl]-3-methoxyimino-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 59451687 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 1-[(3E,13S,17S)-11-[4-(dimethylamino)phenyl]-3-methoxyimino-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)[C@@]1(C)CCC2C3CCC4=C/C(=N/OC)CCC4=C3C(c3ccc(N(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C32H44N2O3/c1-7-37-20-29(35)31(2)17-16-28-26-14-10-22-18-23(33-36-6)11-15-25(22)30(26)27(19-32(28,31)3)21-8-12-24(13-9-21)34(4)5/h8-9,12-13,18,26-28H,7,10-11,14-17,19-20H2,1-6H3/b33-23+/t26?,27?,28?,31-,32+/m1/s1 |
| InChIKey | AIGGNEXXWLSTLB-SPFKKKMPSA-N |
| XLogP | 6.70 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|