About 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid
1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 59451867) has the molecular formula C17H15Cl2NO2
and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid |
| PubChem CID | 59451867 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(-c3cc(Cl)cc(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C17H15Cl2NO2/c18-15-5-13(6-16(19)7-15)12-3-1-11(2-4-12)8-20-9-14(10-20)17(21)22/h1-7,14H,8-10H2,(H,21,22) |
| InChIKey | OMPONMIHTSIPMX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid?
The IUPAC name of 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid (CID 59451867) is 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid.
What is the SMILES notation for 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid?
The canonical SMILES for 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid is O=C(O)C1CN(Cc2ccc(-c3cc(Cl)cc(Cl)c3)cc2)C1.
What is the InChIKey of 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid?
The InChIKey is OMPONMIHTSIPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2NO2/c18-15-5-13(6-16(19)7-15)12-3-1-11(2-4-12)8-20-9-14(10-20)17(21)22/h1-7,14H,8-10H2,(H,21,22).
What are the key properties of 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid?
1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid has a molecular weight of 336.22 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(3,5-dichlorophenyl)phenyl]methyl]azetidine-3-carboxylic acid is sourced from PubChem (CID 59451867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).