C18H13FN4S — CID 59452184
N-(3-fluorophenyl)-7-methyl-6-(1,3-thiazol-2-yl)quinazolin-2-amine (PubChem CID 59452184) has the molecular formula C18H13FN4S and a molecular weight of 336.40 g/mol. Its IUPAC name is N-(3-fluorophenyl)-7-methyl-6-(1,3-thiazol-2-yl)quinazolin-2-amine.
| Compound Name | N-(3-fluorophenyl)-7-methyl-6-(1,3-thiazol-2-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 59452184 |
| Molecular Formula | C18H13FN4S |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-(3-fluorophenyl)-7-methyl-6-(1,3-thiazol-2-yl)quinazolin-2-amine |
| SMILES | Cc1cc2nc(Nc3cccc(F)c3)ncc2cc1-c1nccs1 |
| InChI | InChI=1S/C18H13FN4S/c1-11-7-16-12(8-15(11)17-20-5-6-24-17)10-21-18(23-16)22-14-4-2-3-13(19)9-14/h2-10H,1H3,(H,21,22,23) |
| InChIKey | FTGACLLDAYJYDL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |