C25H26N4O3 — CID 59452466
[4-[[4-[2-(7-methoxy-1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-2-pyridinyl]methanol (PubChem CID 59452466) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is [4-[[4-[2-(7-methoxy-1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-2-pyridinyl]methanol.
| Compound Name | [4-[[4-[2-(7-methoxy-1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 59452466 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [4-[[4-[2-(7-methoxy-1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-2-pyridinyl]methanol |
| SMILES | COc1cccc2c(CCN3CCOc4cc(Nc5ccnc(CO)c5)ccc43)c[nH]c12 |
| InChI | InChI=1S/C25H26N4O3/c1-31-23-4-2-3-21-17(15-27-25(21)23)8-10-29-11-12-32-24-14-18(5-6-22(24)29)28-19-7-9-26-20(13-19)16-30/h2-7,9,13-15,27,30H,8,10-12,16H2,1H3,(H,26,28) |
| InChIKey | SRDIJJKIQIWUAK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|