C28H29F4N5O4 — CID 59453292
3-hydroxy-3-methyl-N-[2-[4-[3-methyl-4-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]butanamide (PubChem CID 59453292) has the molecular formula C28H29F4N5O4 and a molecular weight of 575.56 g/mol. Its IUPAC name is 3-hydroxy-3-methyl-N-[2-[4-[3-methyl-4-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]butanamide.
| Compound Name | 3-hydroxy-3-methyl-N-[2-[4-[3-methyl-4-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 59453292 |
| Molecular Formula | C28H29F4N5O4 |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 3-hydroxy-3-methyl-N-[2-[4-[3-methyl-4-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]butanamide |
| SMILES | Cc1cc(Nc2ncnc3ccn(CCNC(=O)CC(C)(C)O)c23)ccc1Oc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C28H29F4N5O4/c1-17-13-18(7-8-22(17)40-19-5-4-6-20(14-19)41-28(31,32)26(29)30)36-25-24-21(34-16-35-25)9-11-37(24)12-10-33-23(38)15-27(2,3)39/h4-9,11,13-14,16,26,39H,10,12,15H2,1-3H3,(H,33,38)(H,34,35,36) |
| InChIKey | RNVBCBPNTWJVFG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|