C18H24ClN3O4 — CID 59453841
cis-(1R,2S)-2-[[(2S)-2-[(6-chloropyridine-2-carbonyl)amino]hexanoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 59453841) has the molecular formula C18H24ClN3O4 and a molecular weight of 381.86 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[(2S)-2-[(6-chloropyridine-2-carbonyl)amino]hexanoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[[(2S)-2-[(6-chloropyridine-2-carbonyl)amino]hexanoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 59453841 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | cis-(1R,2S)-2-[[(2S)-2-[(6-chloropyridine-2-carbonyl)amino]hexanoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CCCC[C@H](NC(=O)c1cccc(Cl)n1)C(=O)N[C@H]1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H24ClN3O4/c1-2-3-7-14(22-16(23)13-9-5-10-15(19)20-13)17(24)21-12-8-4-6-11(12)18(25)26/h5,9-12,14H,2-4,6-8H2,1H3,(H,21,24)(H,22,23)(H,25,26)/t11-,12+,14+/m1/s1 |
| InChIKey | GRLLVIBTFJDQFW-DYEKYZERSA-N |
| XLogP | 2.39 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|