About 1-cyclobutyl-2,2-dimethylpiperazine
1-cyclobutyl-2,2-dimethylpiperazine (PubChem CID 59454526) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-cyclobutyl-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-cyclobutyl-2,2-dimethylpiperazine |
| PubChem CID | 59454526 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-cyclobutyl-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCCN1C1CCC1 |
| InChI | InChI=1S/C10H20N2/c1-10(2)8-11-6-7-12(10)9-4-3-5-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | IEXHYECWTCLETA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclobutyl-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-2,2-dimethylpiperazine?
The IUPAC name of 1-cyclobutyl-2,2-dimethylpiperazine (CID 59454526) is 1-cyclobutyl-2,2-dimethylpiperazine.
What is the SMILES notation for 1-cyclobutyl-2,2-dimethylpiperazine?
The canonical SMILES for 1-cyclobutyl-2,2-dimethylpiperazine is CC1(C)CNCCN1C1CCC1.
What is the InChIKey of 1-cyclobutyl-2,2-dimethylpiperazine?
The InChIKey is IEXHYECWTCLETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-10(2)8-11-6-7-12(10)9-4-3-5-9/h9,11H,3-8H2,1-2H3.
What are the key properties of 1-cyclobutyl-2,2-dimethylpiperazine?
1-cyclobutyl-2,2-dimethylpiperazine has a molecular weight of 168.28 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-2,2-dimethylpiperazine is sourced from PubChem (CID 59454526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).